C19H20N8 — CID 89493662
1-methyl-2-[1-[2-methyl-6-(5-methyltriazol-1-yl)pyrimidin-4-yl]azetidin-3-yl]benzimidazole (PubChem CID 89493662) has the molecular formula C19H20N8 and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-methyl-2-[1-[2-methyl-6-(5-methyltriazol-1-yl)pyrimidin-4-yl]azetidin-3-yl]benzimidazole.
| Compound Name | 1-methyl-2-[1-[2-methyl-6-(5-methyltriazol-1-yl)pyrimidin-4-yl]azetidin-3-yl]benzimidazole |
|---|---|
| PubChem CID | 89493662 |
| Molecular Formula | C19H20N8 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-methyl-2-[1-[2-methyl-6-(5-methyltriazol-1-yl)pyrimidin-4-yl]azetidin-3-yl]benzimidazole |
| SMILES | Cc1nc(N2CC(c3nc4ccccc4n3C)C2)cc(-n2nncc2C)n1 |
| InChI | InChI=1S/C19H20N8/c1-12-9-20-24-27(12)18-8-17(21-13(2)22-18)26-10-14(11-26)19-23-15-6-4-5-7-16(15)25(19)3/h4-9,14H,10-11H2,1-3H3 |
| InChIKey | UMKKADOZDBPPIQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |