C23H22N4O4S — CID 89494105
(5Z)-5-[[3-[3-(2-morpholin-4-ylethoxy)phenyl]benzimidazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89494105) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is (5Z)-5-[[3-[3-(2-morpholin-4-ylethoxy)phenyl]benzimidazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-[3-(2-morpholin-4-ylethoxy)phenyl]benzimidazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89494105 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (5Z)-5-[[3-[3-(2-morpholin-4-ylethoxy)phenyl]benzimidazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc3ncn(-c4cccc(OCCN5CCOCC5)c4)c3c2)S1 |
| InChI | InChI=1S/C23H22N4O4S/c28-22-21(32-23(29)25-22)13-16-4-5-19-20(12-16)27(15-24-19)17-2-1-3-18(14-17)31-11-8-26-6-9-30-10-7-26/h1-5,12-15H,6-11H2,(H,25,28,29)/b21-13- |
| InChIKey | OVUJORMXDXEPAV-BKUYFWCQSA-N |
| XLogP | 3.06 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|