C22H23N5O2S — CID 89494284
(5Z)-5-[[3-[3-[[ethyl(propyl)amino]methyl]phenyl]imidazo[1,2-b]pyridazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89494284) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is (5Z)-5-[[3-[3-[[ethyl(propyl)amino]methyl]phenyl]imidazo[1,2-b]pyridazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-[3-[[ethyl(propyl)amino]methyl]phenyl]imidazo[1,2-b]pyridazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89494284 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (5Z)-5-[[3-[3-[[ethyl(propyl)amino]methyl]phenyl]imidazo[1,2-b]pyridazin-6-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN(CC)Cc1cccc(-c2cnc3ccc(/C=C4\SC(=O)NC4=O)nn23)c1 |
| InChI | InChI=1S/C22H23N5O2S/c1-3-10-26(4-2)14-15-6-5-7-16(11-15)18-13-23-20-9-8-17(25-27(18)20)12-19-21(28)24-22(29)30-19/h5-9,11-13H,3-4,10,14H2,1-2H3,(H,24,28,29)/b19-12- |
| InChIKey | WWAJYZGFLWIREO-UNOMPAQXSA-N |
| XLogP | 3.95 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|