About 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole
6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole (PubChem CID 89494307) has the molecular formula C18H17ClN6S
and a molecular weight of 384.90 g/mol. Its IUPAC name is 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole |
| PubChem CID | 89494307 |
| Molecular Formula | C18H17ClN6S |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole |
| SMILES | CN1CCN(c2nc3ccc(-c4cnc5ccc(Cl)nn45)cc3s2)CC1 |
| InChI | InChI=1S/C18H17ClN6S/c1-23-6-8-24(9-7-23)18-21-13-3-2-12(10-15(13)26-18)14-11-20-17-5-4-16(19)22-25(14)17/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | KVIXMMCSRHCLAY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole?
The IUPAC name of 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole (CID 89494307) is 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole.
What is the SMILES notation for 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole?
The canonical SMILES for 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole is CN1CCN(c2nc3ccc(-c4cnc5ccc(Cl)nn45)cc3s2)CC1.
What is the InChIKey of 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole?
The InChIKey is KVIXMMCSRHCLAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN6S/c1-23-6-8-24(9-7-23)18-21-13-3-2-12(10-15(13)26-18)14-11-20-17-5-4-16(19)22-25(14)17/h2-5,10-11H,6-9H2,1H3.
What are the key properties of 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole?
6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole has a molecular weight of 384.90 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4-methylpiperazin-1-yl)-1,3-benzothiazole is sourced from PubChem (CID 89494307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).