About 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate
2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate (PubChem CID 89494350) has the molecular formula C16H14ClN3O2
and a molecular weight of 315.76 g/mol. Its IUPAC name is 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate |
| PubChem CID | 89494350 |
| Molecular Formula | C16H14ClN3O2 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate |
| SMILES | CC(=O)OCCc1cccc(-c2cnc3ccc(Cl)nn23)c1 |
| InChI | InChI=1S/C16H14ClN3O2/c1-11(21)22-8-7-12-3-2-4-13(9-12)14-10-18-16-6-5-15(17)19-20(14)16/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | NJXVUZDFSKFPSL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate?
The IUPAC name of 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate (CID 89494350) is 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate.
What is the SMILES notation for 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate?
The canonical SMILES for 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate is CC(=O)OCCc1cccc(-c2cnc3ccc(Cl)nn23)c1.
What is the InChIKey of 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate?
The InChIKey is NJXVUZDFSKFPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3O2/c1-11(21)22-8-7-12-3-2-4-13(9-12)14-10-18-16-6-5-15(17)19-20(14)16/h2-6,9-10H,7-8H2,1H3.
What are the key properties of 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate?
2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate has a molecular weight of 315.76 g/mol, XLogP of 3.16, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)phenyl]ethyl acetate is sourced from PubChem (CID 89494350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).