C20H30N4O3 — CID 89494554
[1-(5-methoxy-2-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate (PubChem CID 89494554) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is [1-(5-methoxy-2-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate.
| Compound Name | [1-(5-methoxy-2-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 89494554 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | [1-(5-methoxy-2-pyridinyl)piperidin-4-yl] 4-cyclobutylpiperazine-1-carboxylate |
| SMILES | COc1ccc(N2CCC(OC(=O)N3CCN(C4CCC4)CC3)CC2)nc1 |
| InChI | InChI=1S/C20H30N4O3/c1-26-18-5-6-19(21-15-18)23-9-7-17(8-10-23)27-20(25)24-13-11-22(12-14-24)16-3-2-4-16/h5-6,15-17H,2-4,7-14H2,1H3 |
| InChIKey | FAKLXXZDSSQXCR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |