C26H51N4O2+ — CID 89494691
diformyl-(2,2,6,6-tetramethylpiperidin-4-yl)-[6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]azanium (PubChem CID 89494691) has the molecular formula C26H51N4O2+ and a molecular weight of 451.72 g/mol. Its IUPAC name is diformyl-(2,2,6,6-tetramethylpiperidin-4-yl)-[6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]azanium.
| Compound Name | diformyl-(2,2,6,6-tetramethylpiperidin-4-yl)-[6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]azanium |
|---|---|
| PubChem CID | 89494691 |
| Molecular Formula | C26H51N4O2+ |
| Molecular Weight | 451.72 g/mol |
| Exact Mass | 451.40 |
| IUPAC Name | diformyl-(2,2,6,6-tetramethylpiperidin-4-yl)-[6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]azanium |
| SMILES | CC1(C)CC(NCCCCCC[N+](C=O)(C=O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C26H51N4O2/c1-23(2)15-21(16-24(3,4)28-23)27-13-11-9-10-12-14-30(19-31,20-32)22-17-25(5,6)29-26(7,8)18-22/h19-22,27-29H,9-18H2,1-8H3/q+1 |
| InChIKey | YFNIXVIOFHZQAZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.72 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|