C43H32F6O4 — CID 89494812
3-O-(2-methylpropyl) 9-O-propan-2-yl 4,10-bis[4-(trifluoromethyl)phenyl]perylene-3,9-dicarboxylate (PubChem CID 89494812) has the molecular formula C43H32F6O4 and a molecular weight of 726.71 g/mol. Its IUPAC name is 3-O-(2-methylpropyl) 9-O-propan-2-yl 4,10-bis[4-(trifluoromethyl)phenyl]perylene-3,9-dicarboxylate.
| Compound Name | 3-O-(2-methylpropyl) 9-O-propan-2-yl 4,10-bis[4-(trifluoromethyl)phenyl]perylene-3,9-dicarboxylate |
|---|---|
| PubChem CID | 89494812 |
| Molecular Formula | C43H32F6O4 |
| Molecular Weight | 726.71 g/mol |
| Exact Mass | 726.22 |
| IUPAC Name | 3-O-(2-methylpropyl) 9-O-propan-2-yl 4,10-bis[4-(trifluoromethyl)phenyl]perylene-3,9-dicarboxylate |
| SMILES | CC(C)COC(=O)c1ccc2c3ccc(-c4ccc(C(F)(F)F)cc4)c4c(C(=O)OC(C)C)ccc(c5ccc(-c6ccc(C(F)(F)F)cc6)c1c52)c43 |
| InChI | InChI=1S/C43H32F6O4/c1-22(2)21-52-40(50)34-19-17-32-31-16-14-29(25-7-11-27(12-8-25)43(47,48)49)37-35(41(51)53-23(3)4)20-18-33(39(31)37)30-15-13-28(36(34)38(30)32)24-5-9-26(10-6-24)42(44,45)46/h5-20,22-23H,21H2,1-4H3 |
| InChIKey | VCWBCLYHUGOGGW-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.71 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|