C11H20N2 — CID 89495189
(3E,5E)-4-N,5-N,2-trimethylocta-1,3,5-triene-4,5-diamine (PubChem CID 89495189) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (3E,5E)-4-N,5-N,2-trimethylocta-1,3,5-triene-4,5-diamine.
| Compound Name | (3E,5E)-4-N,5-N,2-trimethylocta-1,3,5-triene-4,5-diamine |
|---|---|
| PubChem CID | 89495189 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (3E,5E)-4-N,5-N,2-trimethylocta-1,3,5-triene-4,5-diamine |
| SMILES | C=C(C)/C=C(NC)\C(=C/CC)NC |
| InChI | InChI=1S/C11H20N2/c1-6-7-10(12-4)11(13-5)8-9(2)3/h7-8,12-13H,2,6H2,1,3-5H3/b10-7+,11-8+ |
| InChIKey | VQZGMMFCBYAFOH-AMMQDNIMSA-N |
| XLogP | 2.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|