About (5S)-3,5-dimethyl-4,5-dihydropyridazine
(5S)-3,5-dimethyl-4,5-dihydropyridazine (PubChem CID 89495190) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is (5S)-3,5-dimethyl-4,5-dihydropyridazine.
Molecular Properties
| Compound Name | (5S)-3,5-dimethyl-4,5-dihydropyridazine |
| PubChem CID | 89495190 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (5S)-3,5-dimethyl-4,5-dihydropyridazine |
| SMILES | CC1=NN=C[C@@H](C)C1 |
| InChI | InChI=1S/C6H10N2/c1-5-3-6(2)8-7-4-5/h4-5H,3H2,1-2H3/t5-/m0/s1 |
| InChIKey | BVWMTJOQLXPLPT-YFKPBYRVSA-N |
| XLogP | 1.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-3,5-dimethyl-4,5-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3,5-dimethyl-4,5-dihydropyridazine?
The IUPAC name of (5S)-3,5-dimethyl-4,5-dihydropyridazine (CID 89495190) is (5S)-3,5-dimethyl-4,5-dihydropyridazine.
What is the SMILES notation for (5S)-3,5-dimethyl-4,5-dihydropyridazine?
The canonical SMILES for (5S)-3,5-dimethyl-4,5-dihydropyridazine is CC1=NN=C[C@@H](C)C1.
What is the InChIKey of (5S)-3,5-dimethyl-4,5-dihydropyridazine?
The InChIKey is BVWMTJOQLXPLPT-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H10N2/c1-5-3-6(2)8-7-4-5/h4-5H,3H2,1-2H3/t5-/m0/s1.
What are the key properties of (5S)-3,5-dimethyl-4,5-dihydropyridazine?
(5S)-3,5-dimethyl-4,5-dihydropyridazine has a molecular weight of 110.16 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3,5-dimethyl-4,5-dihydropyridazine is sourced from PubChem (CID 89495190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).