C11H15N — CID 89495214
5,8-dimethyl-4a,5,6,7-tetrahydroquinoline (PubChem CID 89495214) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 5,8-dimethyl-4a,5,6,7-tetrahydroquinoline.
| Compound Name | 5,8-dimethyl-4a,5,6,7-tetrahydroquinoline |
|---|---|
| PubChem CID | 89495214 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 5,8-dimethyl-4a,5,6,7-tetrahydroquinoline |
| SMILES | CC1=C2N=CC=CC2C(C)CC1 |
| InChI | InChI=1S/C11H15N/c1-8-5-6-9(2)11-10(8)4-3-7-12-11/h3-4,7-8,10H,5-6H2,1-2H3 |
| InChIKey | LSZNJSMBVMDEEA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |