About 1,3,4-trimethyl-6,7-dihydroisoquinoline
1,3,4-trimethyl-6,7-dihydroisoquinoline (PubChem CID 89495215) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 1,3,4-trimethyl-6,7-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1,3,4-trimethyl-6,7-dihydroisoquinoline |
| PubChem CID | 89495215 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1,3,4-trimethyl-6,7-dihydroisoquinoline |
| SMILES | Cc1nc(C)c2c(c1C)=CCCC=2 |
| InChI | InChI=1S/C12H15N/c1-8-9(2)13-10(3)12-7-5-4-6-11(8)12/h6-7H,4-5H2,1-3H3 |
| InChIKey | OMUWXJRXMVKQHK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3,4-trimethyl-6,7-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4-trimethyl-6,7-dihydroisoquinoline?
The IUPAC name of 1,3,4-trimethyl-6,7-dihydroisoquinoline (CID 89495215) is 1,3,4-trimethyl-6,7-dihydroisoquinoline.
What is the SMILES notation for 1,3,4-trimethyl-6,7-dihydroisoquinoline?
The canonical SMILES for 1,3,4-trimethyl-6,7-dihydroisoquinoline is Cc1nc(C)c2c(c1C)=CCCC=2.
What is the InChIKey of 1,3,4-trimethyl-6,7-dihydroisoquinoline?
The InChIKey is OMUWXJRXMVKQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-8-9(2)13-10(3)12-7-5-4-6-11(8)12/h6-7H,4-5H2,1-3H3.
What are the key properties of 1,3,4-trimethyl-6,7-dihydroisoquinoline?
1,3,4-trimethyl-6,7-dihydroisoquinoline has a molecular weight of 173.26 g/mol, XLogP of 1.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4-trimethyl-6,7-dihydroisoquinoline is sourced from PubChem (CID 89495215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).