About 1,5-dimethyl-6,7-dihydrophthalazine
1,5-dimethyl-6,7-dihydrophthalazine (PubChem CID 89495223) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,5-dimethyl-6,7-dihydrophthalazine.
Molecular Properties
| Compound Name | 1,5-dimethyl-6,7-dihydrophthalazine |
| PubChem CID | 89495223 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1,5-dimethyl-6,7-dihydrophthalazine |
| SMILES | CC1=c2cnnc(C)c2=CCC1 |
| InChI | InChI=1S/C10H12N2/c1-7-4-3-5-9-8(2)12-11-6-10(7)9/h5-6H,3-4H2,1-2H3 |
| InChIKey | SIWPBRZELPXFBB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethyl-6,7-dihydrophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-6,7-dihydrophthalazine?
The IUPAC name of 1,5-dimethyl-6,7-dihydrophthalazine (CID 89495223) is 1,5-dimethyl-6,7-dihydrophthalazine.
What is the SMILES notation for 1,5-dimethyl-6,7-dihydrophthalazine?
The canonical SMILES for 1,5-dimethyl-6,7-dihydrophthalazine is CC1=c2cnnc(C)c2=CCC1.
What is the InChIKey of 1,5-dimethyl-6,7-dihydrophthalazine?
The InChIKey is SIWPBRZELPXFBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-4-3-5-9-8(2)12-11-6-10(7)9/h5-6H,3-4H2,1-2H3.
What are the key properties of 1,5-dimethyl-6,7-dihydrophthalazine?
1,5-dimethyl-6,7-dihydrophthalazine has a molecular weight of 160.22 g/mol, XLogP of 0.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-6,7-dihydrophthalazine is sourced from PubChem (CID 89495223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).