About 3,4-dimethyl-6,7-dihydrocinnoline
3,4-dimethyl-6,7-dihydrocinnoline (PubChem CID 89495252) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 3,4-dimethyl-6,7-dihydrocinnoline.
Molecular Properties
| Compound Name | 3,4-dimethyl-6,7-dihydrocinnoline |
| PubChem CID | 89495252 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3,4-dimethyl-6,7-dihydrocinnoline |
| SMILES | Cc1nnc2c(c1C)=CCCC=2 |
| InChI | InChI=1S/C10H12N2/c1-7-8(2)11-12-10-6-4-3-5-9(7)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | LBPZQVHWCHESDQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dimethyl-6,7-dihydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-6,7-dihydrocinnoline?
The IUPAC name of 3,4-dimethyl-6,7-dihydrocinnoline (CID 89495252) is 3,4-dimethyl-6,7-dihydrocinnoline.
What is the SMILES notation for 3,4-dimethyl-6,7-dihydrocinnoline?
The canonical SMILES for 3,4-dimethyl-6,7-dihydrocinnoline is Cc1nnc2c(c1C)=CCCC=2.
What is the InChIKey of 3,4-dimethyl-6,7-dihydrocinnoline?
The InChIKey is LBPZQVHWCHESDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-8(2)11-12-10-6-4-3-5-9(7)10/h5-6H,3-4H2,1-2H3.
What are the key properties of 3,4-dimethyl-6,7-dihydrocinnoline?
3,4-dimethyl-6,7-dihydrocinnoline has a molecular weight of 160.22 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-6,7-dihydrocinnoline is sourced from PubChem (CID 89495252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).