C12H20O5 — CID 89495344
(3aR,5S,6R,6aR)-6-butoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbaldehyde (PubChem CID 89495344) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-6-butoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbaldehyde.
| Compound Name | (3aR,5S,6R,6aR)-6-butoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 89495344 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (3aR,5S,6R,6aR)-6-butoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbaldehyde |
| SMILES | CCCCO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C=O |
| InChI | InChI=1S/C12H20O5/c1-4-5-6-14-9-8(7-13)15-11-10(9)16-12(2,3)17-11/h7-11H,4-6H2,1-3H3/t8-,9-,10-,11-/m1/s1 |
| InChIKey | YVUZWKSZIGYXDO-GWOFURMSSA-N |
| XLogP | 1.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|