C44H34N10 — CID 89495709
2-[7'-(1-methyl-2,6-dipyridin-2-yl-2H-1,3,5-triazin-4-yl)spiro[cyclopentane-1,9'-fluorene]-2'-yl]-4,6-dipyridin-2-yl-1,3,5-triazine (PubChem CID 89495709) has the molecular formula C44H34N10 and a molecular weight of 702.83 g/mol. Its IUPAC name is 2-[7'-(1-methyl-2,6-dipyridin-2-yl-2H-1,3,5-triazin-4-yl)spiro[cyclopentane-1,9'-fluorene]-2'-yl]-4,6-dipyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-[7'-(1-methyl-2,6-dipyridin-2-yl-2H-1,3,5-triazin-4-yl)spiro[cyclopentane-1,9'-fluorene]-2'-yl]-4,6-dipyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 89495709 |
| Molecular Formula | C44H34N10 |
| Molecular Weight | 702.83 g/mol |
| Exact Mass | 702.30 |
| IUPAC Name | 2-[7'-(1-methyl-2,6-dipyridin-2-yl-2H-1,3,5-triazin-4-yl)spiro[cyclopentane-1,9'-fluorene]-2'-yl]-4,6-dipyridin-2-yl-1,3,5-triazine |
| SMILES | CN1C(c2ccccn2)=NC(c2ccc3c(c2)C2(CCCC2)c2cc(-c4nc(-c5ccccn5)nc(-c5ccccn5)n4)ccc2-3)=NC1c1ccccn1 |
| InChI | InChI=1S/C44H34N10/c1-54-42(36-14-4-10-24-47-36)52-39(53-43(54)37-15-5-11-25-48-37)29-17-19-31-30-18-16-28(26-32(30)44(33(31)27-29)20-6-7-21-44)38-49-40(34-12-2-8-22-45-34)51-41(50-38)35-13-3-9-23-46-35/h2-5,8-19,22-27,42H,6-7,20-21H2,1H3 |
| InChIKey | SJXICOVPVBTHKX-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 118.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.83 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |