C27H37N5O3S — CID 89495723
4-[2-(butylamino)-5-(4-piperidin-1-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol (PubChem CID 89495723) has the molecular formula C27H37N5O3S and a molecular weight of 511.69 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-(4-piperidin-1-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-(4-piperidin-1-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 89495723 |
| Molecular Formula | C27H37N5O3S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 4-[2-(butylamino)-5-(4-piperidin-1-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(=O)(=O)N4CCCCC4)cc3)cn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C27H37N5O3S/c1-2-3-15-28-27-29-18-24-25(19-32(26(24)30-27)21-9-11-22(33)12-10-21)20-7-13-23(14-8-20)36(34,35)31-16-5-4-6-17-31/h7-8,13-14,18-19,21-22,33H,2-6,9-12,15-17H2,1H3,(H,28,29,30) |
| InChIKey | JNOZPOGAIWIGDX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|