C27H35F2N5O3S — CID 89495747
4-[2-(butylamino)-5-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol (PubChem CID 89495747) has the molecular formula C27H35F2N5O3S and a molecular weight of 547.67 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 89495747 |
| Molecular Formula | C27H35F2N5O3S |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 4-[2-(butylamino)-5-[4-(4,4-difluoropiperidin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(=O)(=O)N4CCC(F)(F)CC4)cc3)cn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C27H35F2N5O3S/c1-2-3-14-30-26-31-17-23-24(18-34(25(23)32-26)20-6-8-21(35)9-7-20)19-4-10-22(11-5-19)38(36,37)33-15-12-27(28,29)13-16-33/h4-5,10-11,17-18,20-21,35H,2-3,6-9,12-16H2,1H3,(H,30,31,32) |
| InChIKey | FEXRSRXFBIRFMY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|