C26H35FN6O3S — CID 89495755
7-(4-aminocyclohexyl)-N-butyl-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 89495755) has the molecular formula C26H35FN6O3S and a molecular weight of 530.67 g/mol. Its IUPAC name is 7-(4-aminocyclohexyl)-N-butyl-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-(4-aminocyclohexyl)-N-butyl-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 89495755 |
| Molecular Formula | C26H35FN6O3S |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 7-(4-aminocyclohexyl)-N-butyl-5-(3-fluoro-4-morpholin-4-ylsulfonylphenyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(=O)(=O)N4CCOCC4)c(F)c3)cn(C3CCC(N)CC3)c2n1 |
| InChI | InChI=1S/C26H35FN6O3S/c1-2-3-10-29-26-30-16-21-22(17-33(25(21)31-26)20-7-5-19(28)6-8-20)18-4-9-24(23(27)15-18)37(34,35)32-11-13-36-14-12-32/h4,9,15-17,19-20H,2-3,5-8,10-14,28H2,1H3,(H,29,30,31) |
| InChIKey | ISOYAPPKZDNVQA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|