C27H38N6O — CID 89495758
4-[2-(butylamino)-5-[4-(piperazin-1-ylmethyl)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol (PubChem CID 89495758) has the molecular formula C27H38N6O and a molecular weight of 462.64 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-[4-(piperazin-1-ylmethyl)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-[4-(piperazin-1-ylmethyl)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 89495758 |
| Molecular Formula | C27H38N6O |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | 4-[2-(butylamino)-5-[4-(piperazin-1-ylmethyl)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(CN4CCNCC4)cc3)cn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C27H38N6O/c1-2-3-12-29-27-30-17-24-25(19-33(26(24)31-27)22-8-10-23(34)11-9-22)21-6-4-20(5-7-21)18-32-15-13-28-14-16-32/h4-7,17,19,22-23,28,34H,2-3,8-16,18H2,1H3,(H,29,30,31) |
| InChIKey | SLCVMWQKWVHPQE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|