C27H37FN6O3S — CID 89495775
4-[2-(butylamino)-5-[3-fluoro-4-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol (PubChem CID 89495775) has the molecular formula C27H37FN6O3S and a molecular weight of 544.70 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-[3-fluoro-4-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-[3-fluoro-4-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 89495775 |
| Molecular Formula | C27H37FN6O3S |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 4-[2-(butylamino)-5-[3-fluoro-4-(4-methylpiperazin-1-yl)sulfonylphenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(-c3ccc(S(=O)(=O)N4CCN(C)CC4)c(F)c3)cn(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C27H37FN6O3S/c1-3-4-11-29-27-30-17-22-23(18-34(26(22)31-27)20-6-8-21(35)9-7-20)19-5-10-25(24(28)16-19)38(36,37)33-14-12-32(2)13-15-33/h5,10,16-18,20-21,35H,3-4,6-9,11-15H2,1-2H3,(H,29,30,31) |
| InChIKey | DCFNMFYAKVXCLN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|