C31H20F6N2 — CID 89495787
N'-[(Z)-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-9,9'-spirobi[fluorene]-2-carboximidamide (PubChem CID 89495787) has the molecular formula C31H20F6N2 and a molecular weight of 534.50 g/mol. Its IUPAC name is N'-[(Z)-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-9,9'-spirobi[fluorene]-2-carboximidamide.
| Compound Name | N'-[(Z)-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-9,9'-spirobi[fluorene]-2-carboximidamide |
|---|---|
| PubChem CID | 89495787 |
| Molecular Formula | C31H20F6N2 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | N'-[(Z)-1,1,1,5,5,5-hexafluoropent-2-en-2-yl]-9,9'-spirobi[fluorene]-2-carboximidamide |
| SMILES | N/C(=N\C(=C/CC(F)(F)F)C(F)(F)F)c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2 |
| InChI | InChI=1S/C31H20F6N2/c32-29(33,34)16-15-27(31(35,36)37)39-28(38)18-13-14-22-21-9-3-6-12-25(21)30(26(22)17-18)23-10-4-1-7-19(23)20-8-2-5-11-24(20)30/h1-15,17H,16H2,(H2,38,39)/b27-15- |
| InChIKey | YEXYFZYSVFCPOG-DICXZTSXSA-N |
| XLogP | 8.13 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|