C24H23N5S — CID 89496016
2-(1,4,5,6-tetrahydropyrimidin-2-yl)-6-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzothiophen-2-yl]-1H-indole (PubChem CID 89496016) has the molecular formula C24H23N5S and a molecular weight of 413.55 g/mol. Its IUPAC name is 2-(1,4,5,6-tetrahydropyrimidin-2-yl)-6-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzothiophen-2-yl]-1H-indole.
| Compound Name | 2-(1,4,5,6-tetrahydropyrimidin-2-yl)-6-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzothiophen-2-yl]-1H-indole |
|---|---|
| PubChem CID | 89496016 |
| Molecular Formula | C24H23N5S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-(1,4,5,6-tetrahydropyrimidin-2-yl)-6-[6-(1,4,5,6-tetrahydropyrimidin-2-yl)-1-benzothiophen-2-yl]-1H-indole |
| SMILES | c1cc2cc(-c3ccc4cc(C5=NCCCN5)[nH]c4c3)sc2cc1C1=NCCCN1 |
| InChI | InChI=1S/C24H23N5S/c1-7-25-23(26-8-1)18-6-5-17-13-21(30-22(17)14-18)16-4-3-15-11-20(29-19(15)12-16)24-27-9-2-10-28-24/h3-6,11-14,29H,1-2,7-10H2,(H,25,26)(H,27,28) |
| InChIKey | JEOPPKWTIRDLAH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |