C20H19N3O5S — CID 8949636
[(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate (PubChem CID 8949636) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate.
| Compound Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 8949636 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetate |
| SMILES | C[C@H](OC(=O)C[C@H]1Sc2ccccc2NC1=O)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19N3O5S/c1-12(18(25)22-23-19(26)13-7-3-2-4-8-13)28-17(24)11-16-20(27)21-14-9-5-6-10-15(14)29-16/h2-10,12,16H,11H2,1H3,(H,21,27)(H,22,25)(H,23,26)/t12-,16+/m0/s1 |
| InChIKey | UPCBIDMXNHNVPC-BLLLJJGKSA-N |
| XLogP | 1.88 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|