About 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron
1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron (PubChem CID 89496918) has the molecular formula C14H20FeN2-6
and a molecular weight of 272.17 g/mol. Its IUPAC name is 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron.
Molecular Properties
| Compound Name | 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron |
| PubChem CID | 89496918 |
| Molecular Formula | C14H20FeN2-6 |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron |
| SMILES | CN(C)C[c-]1cccc1CN.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C9H15N2.C5H5.Fe/c1-11(2)7-9-5-3-4-8(9)6-10;1-2-4-5-3-1;/h3-5H,6-7,10H2,1-2H3;1-5H;/q-1;-5; |
| InChIKey | NEXGMQJQWOIEOU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron?
The IUPAC name of 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron (CID 89496918) is 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron.
What is the SMILES notation for 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron?
The canonical SMILES for 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron is CN(C)C[c-]1cccc1CN.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron?
The InChIKey is NEXGMQJQWOIEOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N2.C5H5.Fe/c1-11(2)7-9-5-3-4-8(9)6-10;1-2-4-5-3-1;/h3-5H,6-7,10H2,1-2H3;1-5H;/q-1;-5;.
What are the key properties of 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron?
1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron has a molecular weight of 272.17 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(aminomethyl)cyclopenta-2,4-dien-1-yl]-N,N-dimethylmethanamine;cyclopentane;iron is sourced from PubChem (CID 89496918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).