About cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid
cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid (PubChem CID 89497235) has the molecular formula C18H19F5N4O2
and a molecular weight of 418.37 g/mol. Its IUPAC name is cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid.
Molecular Properties
| Compound Name | cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid |
| PubChem CID | 89497235 |
| Molecular Formula | C18H19F5N4O2 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid |
| SMILES | CC(NC(=O)O)c1ncc(Nc2c(F)cccc2C(F)(F)F)cc1F.NC1CC1 |
| InChI | InChI=1S/C15H12F5N3O2.C3H7N/c1-7(22-14(24)25)12-11(17)5-8(6-21-12)23-13-9(15(18,19)20)3-2-4-10(13)16;4-3-1-2-3/h2-7,22-23H,1H3,(H,24,25);3H,1-2,4H2 |
| InChIKey | HAEYDUFUVCBZHS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid?
The IUPAC name of cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid (CID 89497235) is cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid.
What is the SMILES notation for cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid?
The canonical SMILES for cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid is CC(NC(=O)O)c1ncc(Nc2c(F)cccc2C(F)(F)F)cc1F.NC1CC1.
What is the InChIKey of cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid?
The InChIKey is HAEYDUFUVCBZHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F5N3O2.C3H7N/c1-7(22-14(24)25)12-11(17)5-8(6-21-12)23-13-9(15(18,19)20)3-2-4-10(13)16;4-3-1-2-3/h2-7,22-23H,1H3,(H,24,25);3H,1-2,4H2.
What are the key properties of cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid?
cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid has a molecular weight of 418.37 g/mol, XLogP of 4.56, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanamine;1-[3-fluoro-5-[2-fluoro-6-(trifluoromethyl)anilino]-2-pyridinyl]ethylcarbamic acid is sourced from PubChem (CID 89497235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).