C20H33BN2O2 — CID 89498319
1-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 89498319) has the molecular formula C20H33BN2O2 and a molecular weight of 344.31 g/mol. Its IUPAC name is 1-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 89498319 |
| Molecular Formula | C20H33BN2O2 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 1-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cc1c(B2OC(C)(C)C(C)(C)O2)cnn1C[C@@H]1CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C20H33BN2O2/c1-13-17(21-24-19(4,5)20(6,7)25-21)11-22-23(13)12-14-8-9-15-10-16(14)18(15,2)3/h11,14-16H,8-10,12H2,1-7H3/t14-,15-,16-/m0/s1 |
| InChIKey | VADALELJZZOBLL-JYJNAYRXSA-N |
| XLogP | 3.56 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|