About 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole
1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole (PubChem CID 89498327) has the molecular formula C16H28N2O
and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole.
Molecular Properties
| Compound Name | 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole |
| PubChem CID | 89498327 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole |
| SMILES | COCCC1(Cn2nccc2C)CCCC(C)(C)C1 |
| InChI | InChI=1S/C16H28N2O/c1-14-6-10-17-18(14)13-16(9-11-19-4)8-5-7-15(2,3)12-16/h6,10H,5,7-9,11-13H2,1-4H3 |
| InChIKey | XWTAOZWUQVJPGJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole?
The IUPAC name of 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole (CID 89498327) is 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole.
What is the SMILES notation for 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole?
The canonical SMILES for 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole is COCCC1(Cn2nccc2C)CCCC(C)(C)C1.
What is the InChIKey of 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole?
The InChIKey is XWTAOZWUQVJPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O/c1-14-6-10-17-18(14)13-16(9-11-19-4)8-5-7-15(2,3)12-16/h6,10H,5,7-9,11-13H2,1-4H3.
What are the key properties of 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole?
1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole has a molecular weight of 264.41 g/mol, XLogP of 3.81, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-(2-methoxyethyl)-3,3-dimethylcyclohexyl]methyl]-5-methylpyrazole is sourced from PubChem (CID 89498327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).