About 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole
1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole (PubChem CID 89498584) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole.
Molecular Properties
| Compound Name | 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole |
| PubChem CID | 89498584 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole |
| SMILES | Cc1ccnn1C[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C12H16N2/c1-9-4-5-13-14(9)8-12-7-10-2-3-11(12)6-10/h2-5,10-12H,6-8H2,1H3/t10-,11-,12-/m0/s1 |
| InChIKey | IIXUCNQHFYARCX-SRVKXCTJSA-N |
| XLogP | 2.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole?
The IUPAC name of 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole (CID 89498584) is 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole.
What is the SMILES notation for 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole?
The canonical SMILES for 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole is Cc1ccnn1C[C@@H]1C[C@H]2C=C[C@H]1C2.
What is the InChIKey of 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole?
The InChIKey is IIXUCNQHFYARCX-SRVKXCTJSA-N. The full InChI is InChI=1S/C12H16N2/c1-9-4-5-13-14(9)8-12-7-10-2-3-11(12)6-10/h2-5,10-12H,6-8H2,1H3/t10-,11-,12-/m0/s1.
What are the key properties of 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole?
1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole has a molecular weight of 188.27 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-methylpyrazole is sourced from PubChem (CID 89498584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).