About 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine
3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine (PubChem CID 89498759) has the molecular formula C16H14F3N3OS2
and a molecular weight of 385.44 g/mol. Its IUPAC name is 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine |
| PubChem CID | 89498759 |
| Molecular Formula | C16H14F3N3OS2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine |
| SMILES | CSc1nc2ccc(Cc3c(OC(F)(F)F)ccc(N)c3N)cc2s1 |
| InChI | InChI=1S/C16H14F3N3OS2/c1-24-15-22-11-4-2-8(7-13(11)25-15)6-9-12(23-16(17,18)19)5-3-10(20)14(9)21/h2-5,7H,6,20-21H2,1H3 |
| InChIKey | DXCTVFINFWTOHU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine?
The IUPAC name of 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine (CID 89498759) is 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine.
What is the SMILES notation for 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine?
The canonical SMILES for 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine is CSc1nc2ccc(Cc3c(OC(F)(F)F)ccc(N)c3N)cc2s1.
What is the InChIKey of 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine?
The InChIKey is DXCTVFINFWTOHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3N3OS2/c1-24-15-22-11-4-2-8(7-13(11)25-15)6-9-12(23-16(17,18)19)5-3-10(20)14(9)21/h2-5,7H,6,20-21H2,1H3.
What are the key properties of 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine?
3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine has a molecular weight of 385.44 g/mol, XLogP of 4.67, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)methyl]-4-(trifluoromethoxy)benzene-1,2-diamine is sourced from PubChem (CID 89498759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).