C22H22N8O2S — CID 89498860
3-[[6-[[6-(1,2,4-triazol-1-yl)imidazo[4,5-b]pyridin-3-yl]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexane-1,2-diol (PubChem CID 89498860) has the molecular formula C22H22N8O2S and a molecular weight of 462.54 g/mol. Its IUPAC name is 3-[[6-[[6-(1,2,4-triazol-1-yl)imidazo[4,5-b]pyridin-3-yl]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexane-1,2-diol.
| Compound Name | 3-[[6-[[6-(1,2,4-triazol-1-yl)imidazo[4,5-b]pyridin-3-yl]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 89498860 |
| Molecular Formula | C22H22N8O2S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 3-[[6-[[6-(1,2,4-triazol-1-yl)imidazo[4,5-b]pyridin-3-yl]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexane-1,2-diol |
| SMILES | OC1CCCC(Nc2nc3ccc(Cn4cnc5cc(-n6cncn6)cnc54)cc3s2)C1O |
| InChI | InChI=1S/C22H22N8O2S/c31-18-3-1-2-16(20(18)32)28-22-27-15-5-4-13(6-19(15)33-22)9-29-12-25-17-7-14(8-24-21(17)29)30-11-23-10-26-30/h4-8,10-12,16,18,20,31-32H,1-3,9H2,(H,27,28) |
| InChIKey | QVZIOQTUFYZNFY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |