About 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone
1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone (PubChem CID 89499579) has the molecular formula C22H17N3O3
and a molecular weight of 371.40 g/mol. Its IUPAC name is 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone.
Molecular Properties
| Compound Name | 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone |
| PubChem CID | 89499579 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.[N-]=[N+]=Nc1ccc(C(=O)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H9N3O2.C8H8O/c15-17-16-12-8-6-11(7-9-12)14(19)13(18)10-4-2-1-3-5-10;1-7(9)8-5-3-2-4-6-8/h1-9H;2-6H,1H3 |
| InChIKey | JIHHCPDGYADSKV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 99.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone?
The IUPAC name of 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone (CID 89499579) is 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone.
What is the SMILES notation for 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone?
The canonical SMILES for 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone is CC(=O)c1ccccc1.[N-]=[N+]=Nc1ccc(C(=O)C(=O)c2ccccc2)cc1.
What is the InChIKey of 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone?
The InChIKey is JIHHCPDGYADSKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O2.C8H8O/c15-17-16-12-8-6-11(7-9-12)14(19)13(18)10-4-2-1-3-5-10;1-7(9)8-5-3-2-4-6-8/h1-9H;2-6H,1H3.
What are the key properties of 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone?
1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone has a molecular weight of 371.40 g/mol, XLogP of 5.58, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-azidophenyl)-2-phenylethane-1,2-dione;1-phenylethanone is sourced from PubChem (CID 89499579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).