C30H30F2N6O — CID 89509259
N-[(2R,3R,5S)-1-[(2,6-difluorophenyl)methyl]-2,5-dimethylpiperidin-3-yl]-3-(2-methylindazol-5-yl)-1H-indazole-5-carboxamide (PubChem CID 89509259) has the molecular formula C30H30F2N6O and a molecular weight of 528.60 g/mol. Its IUPAC name is N-[(2R,3R,5S)-1-[(2,6-difluorophenyl)methyl]-2,5-dimethylpiperidin-3-yl]-3-(2-methylindazol-5-yl)-1H-indazole-5-carboxamide.
| Compound Name | N-[(2R,3R,5S)-1-[(2,6-difluorophenyl)methyl]-2,5-dimethylpiperidin-3-yl]-3-(2-methylindazol-5-yl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 89509259 |
| Molecular Formula | C30H30F2N6O |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | N-[(2R,3R,5S)-1-[(2,6-difluorophenyl)methyl]-2,5-dimethylpiperidin-3-yl]-3-(2-methylindazol-5-yl)-1H-indazole-5-carboxamide |
| SMILES | C[C@H]1C[C@H]([C@H](N(C1)CC2=C(C=CC=C2F)F)C)NC(=O)C3=CC4=C(C=C3)NN=C4C5=CC6=CN(N=C6C=C5)C |
| InChI | InChI=1S/C30H30F2N6O/c1-17-11-28(18(2)38(14-17)16-23-24(31)5-4-6-25(23)32)33-30(39)20-8-10-27-22(13-20)29(35-34-27)19-7-9-26-21(12-19)15-37(3)36-26/h4-10,12-13,15,17-18,28H,11,14,16H2,1-3H3,(H,33,39)(H,34,35)/t17-,18+,28+/m0/s1 |
| InChIKey | VUOFBDIDBLZEPX-QLPUUCHCSA-N |
| XLogP | 5.30 |
| TPSA | 78.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | 855 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |