C12H10N2O5 — CID 8951271
4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-3-nitrobenzaldehyde (PubChem CID 8951271) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-3-nitrobenzaldehyde.
| Compound Name | 4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 8951271 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-3-nitrobenzaldehyde |
| SMILES | Cc1cc(COc2ccc(C=O)cc2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C12H10N2O5/c1-8-4-10(13-19-8)7-18-12-3-2-9(6-15)5-11(12)14(16)17/h2-6H,7H2,1H3 |
| InChIKey | XXHCCBYPRFMSKZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|