About 1,1,1-Trifluoro-3-methylideneheptane-2,4-dione
1,1,1-Trifluoro-3-methylideneheptane-2,4-dione (PubChem CID 89519424) has the molecular formula C8H9F3O2
and a molecular weight of 194.15 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-methylideneheptane-2,4-dione.
Molecular Properties
| Compound Name | 1,1,1-Trifluoro-3-methylideneheptane-2,4-dione |
| PubChem CID | 89519424 |
| Molecular Formula | C8H9F3O2 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 1,1,1-trifluoro-3-methylideneheptane-2,4-dione |
| SMILES | CCCC(=O)C(=C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O2/c1-3-4-6(12)5(2)7(13)8(9,10)11/h2-4H2,1H3 |
| InChIKey | YSDUWMYSPIRITN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | 240 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 1,1,1-Trifluoro-3-methylideneheptane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-Trifluoro-3-methylideneheptane-2,4-dione?
The IUPAC name of 1,1,1-Trifluoro-3-methylideneheptane-2,4-dione (CID 89519424) is 1,1,1-trifluoro-3-methylideneheptane-2,4-dione.
What is the SMILES notation for 1,1,1-Trifluoro-3-methylideneheptane-2,4-dione?
The canonical SMILES for 1,1,1-Trifluoro-3-methylideneheptane-2,4-dione is CCCC(=O)C(=C)C(=O)C(F)(F)F.
What is the InChIKey of 1,1,1-Trifluoro-3-methylideneheptane-2,4-dione?
The InChIKey is YSDUWMYSPIRITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3O2/c1-3-4-6(12)5(2)7(13)8(9,10)11/h2-4H2,1H3.
What are the key properties of 1,1,1-Trifluoro-3-methylideneheptane-2,4-dione?
1,1,1-Trifluoro-3-methylideneheptane-2,4-dione has a molecular weight of 194.15 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-Trifluoro-3-methylideneheptane-2,4-dione is sourced from PubChem (CID 89519424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).