C16H10F4O3 — CID 895212
4-[2,3,5,6-tetrafluoro-4-[(E)-prop-1-enyl]phenoxy]benzoic acid (PubChem CID 895212) has the molecular formula C16H10F4O3 and a molecular weight of 326.25 g/mol. Its IUPAC name is 4-[2,3,5,6-tetrafluoro-4-[(E)-prop-1-enyl]phenoxy]benzoic acid.
| Compound Name | 4-[2,3,5,6-tetrafluoro-4-[(E)-prop-1-enyl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 895212 |
| Molecular Formula | C16H10F4O3 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-[2,3,5,6-tetrafluoro-4-[(E)-prop-1-enyl]phenoxy]benzoic acid |
| SMILES | C/C=C/c1c(F)c(F)c(Oc2ccc(C(=O)O)cc2)c(F)c1F |
| InChI | InChI=1S/C16H10F4O3/c1-2-3-10-11(17)13(19)15(14(20)12(10)18)23-9-6-4-8(5-7-9)16(21)22/h2-7H,1H3,(H,21,22)/b3-2+ |
| InChIKey | JPLMUUCPIHXJTA-NSCUHMNNSA-N |
| XLogP | 4.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|