C18H22N2O3S — CID 895241
1-benzylsulfonyl-4-(4-methoxyphenyl)piperazine (PubChem CID 895241) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-benzylsulfonyl-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 895241 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-benzylsulfonyl-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C18H22N2O3S/c1-23-18-9-7-17(8-10-18)19-11-13-20(14-12-19)24(21,22)15-16-5-3-2-4-6-16/h2-10H,11-15H2,1H3 |
| InChIKey | XEYPZTXTFIEEAG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|