About 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one
3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one (PubChem CID 895297) has the molecular formula C18H14N2O2
and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one.
Molecular Properties
| Compound Name | 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one |
| PubChem CID | 895297 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one |
| SMILES | Cc1ccc2c(c1)c(C1=c3ccccc3=NC1=O)c(O)n2C |
| InChI | InChI=1S/C18H14N2O2/c1-10-7-8-14-12(9-10)16(18(22)20(14)2)15-11-5-3-4-6-13(11)19-17(15)21/h3-9,22H,1-2H3 |
| InChIKey | RVDGEFZLFDXGLC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one?
The IUPAC name of 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one (CID 895297) is 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one.
What is the SMILES notation for 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one?
The canonical SMILES for 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one is Cc1ccc2c(c1)c(C1=c3ccccc3=NC1=O)c(O)n2C.
What is the InChIKey of 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one?
The InChIKey is RVDGEFZLFDXGLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O2/c1-10-7-8-14-12(9-10)16(18(22)20(14)2)15-11-5-3-4-6-13(11)19-17(15)21/h3-9,22H,1-2H3.
What are the key properties of 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one?
3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one has a molecular weight of 290.32 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxy-1,5-dimethylindol-3-yl)indol-2-one is sourced from PubChem (CID 895297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).