About Sulfoxone Sodium
Sulfoxone Sodium (PubChem CID 8954) has the molecular formula C14H14N2Na2O6S3
and a molecular weight of 448.50 g/mol. Its IUPAC name is disodium;[4-[4-(sulfinatomethylamino)phenyl]sulfonylanilino]methanesulfinate.
Molecular Properties
| Compound Name | Sulfoxone Sodium |
| PubChem CID | 8954 |
| Molecular Formula | C14H14N2Na2O6S3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | disodium;[4-[4-(sulfinatomethylamino)phenyl]sulfonylanilino]methanesulfinate |
| SMILES | C1=CC(=CC=C1NCS(=O)[O-])S(=O)(=O)C2=CC=C(C=C2)NCS(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C14H16N2O6S3.2Na/c17-23(18)9-15-11-1-5-13(6-2-11)25(21,22)14-7-3-12(4-8-14)16-10-24(19)20;;/h1-8,15-16H,9-10H2,(H,17,18)(H,19,20);;/q;2*+1/p-2 |
| InChIKey | AZBNFLZFSZDPQF-UHFFFAOYSA-L |
| XLogP | — |
| TPSA | 185.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | 509 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze Sulfoxone Sodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sulfoxone Sodium?
The IUPAC name of Sulfoxone Sodium (CID 8954) is disodium;[4-[4-(sulfinatomethylamino)phenyl]sulfonylanilino]methanesulfinate.
What is the SMILES notation for Sulfoxone Sodium?
The canonical SMILES for Sulfoxone Sodium is C1=CC(=CC=C1NCS(=O)[O-])S(=O)(=O)C2=CC=C(C=C2)NCS(=O)[O-].[Na+].[Na+].
What is the InChIKey of Sulfoxone Sodium?
The InChIKey is AZBNFLZFSZDPQF-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H16N2O6S3.2Na/c17-23(18)9-15-11-1-5-13(6-2-11)25(21,22)14-7-3-12(4-8-14)16-10-24(19)20;;/h1-8,15-16H,9-10H2,(H,17,18)(H,19,20);;/q;2*+1/p-2.
What are the key properties of Sulfoxone Sodium?
Sulfoxone Sodium has a molecular weight of 448.50 g/mol, XLogP of not available, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for Sulfoxone Sodium is sourced from PubChem (CID 8954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).