C22H24N2O5 — CID 8954370
[2-(2,4-diacetamidophenyl)-2-oxoethyl] 2-methyl-2-phenylpropanoate (PubChem CID 8954370) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-(2,4-diacetamidophenyl)-2-oxoethyl] 2-methyl-2-phenylpropanoate.
| Compound Name | [2-(2,4-diacetamidophenyl)-2-oxoethyl] 2-methyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 8954370 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-(2,4-diacetamidophenyl)-2-oxoethyl] 2-methyl-2-phenylpropanoate |
| SMILES | CC(=O)Nc1ccc(C(=O)COC(=O)C(C)(C)c2ccccc2)c(NC(C)=O)c1 |
| InChI | InChI=1S/C22H24N2O5/c1-14(25)23-17-10-11-18(19(12-17)24-15(2)26)20(27)13-29-21(28)22(3,4)16-8-6-5-7-9-16/h5-12H,13H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | DPNVDPNPAUUDOR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |