About 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one
3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 895503) has the molecular formula C20H22N2O
and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one |
| PubChem CID | 895503 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | CC1(C)CC(=O)C=C(Nc2ccc(Nc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C20H22N2O/c1-20(2)13-18(12-19(23)14-20)22-17-10-8-16(9-11-17)21-15-6-4-3-5-7-15/h3-12,21-22H,13-14H2,1-2H3 |
| InChIKey | XPDVZCSPFJQAGU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one?
The IUPAC name of 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one (CID 895503) is 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one is CC1(C)CC(=O)C=C(Nc2ccc(Nc3ccccc3)cc2)C1.
What is the InChIKey of 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one?
The InChIKey is XPDVZCSPFJQAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O/c1-20(2)13-18(12-19(23)14-20)22-17-10-8-16(9-11-17)21-15-6-4-3-5-7-15/h3-12,21-22H,13-14H2,1-2H3.
What are the key properties of 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one?
3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one has a molecular weight of 306.41 g/mol, XLogP of 5.12, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-anilinoanilino)-5,5-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 895503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).