C20H18ClNO5 — CID 8955034
[(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 8955034) has the molecular formula C20H18ClNO5 and a molecular weight of 387.82 g/mol. Its IUPAC name is [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8955034 |
| Molecular Formula | C20H18ClNO5 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [(2S)-1-(2-chloroanilino)-1-oxopropan-2-yl] 3-(methoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | COCc1c(C(=O)O[C@@H](C)C(=O)Nc2ccccc2Cl)oc2ccccc12 |
| InChI | InChI=1S/C20H18ClNO5/c1-12(19(23)22-16-9-5-4-8-15(16)21)26-20(24)18-14(11-25-2)13-7-3-6-10-17(13)27-18/h3-10,12H,11H2,1-2H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | KSWZMUHOMQBHJA-LBPRGKRZSA-N |
| XLogP | 4.42 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |