Quinoline derivative 3

C25H23N3O2 — CID 89554768

IUPAC4-(4-methoxyphenyl)-7-(1-pyridin-3-ylpropan-2-yl)quinoline-2-carboxamide
SMILESCC(CC1=CN=CC=C1)C2=CC3=C(C=C2)C(=CC(=N3)C(=O)N)C4=CC=C(C=C4)OC
InChIInChI=1S/C25H23N3O2/c1-16(12-17-4-3-11-27-15-17)19-7-10-21-22(18-5-8-20(30-2)9-6-18)14-24(25(26)29)28-23(21)13-19/h3-11,13-16H,12H2,1-2H3,(H2,26,29)
InChIKeySLSRIELIUCLTJB-UHFFFAOYSA-N
MW397.50 g/mol
LogP4.50
Rot. Bonds6

About Quinoline derivative 3

Quinoline derivative 3 (PubChem CID 89554768) has the molecular formula C25H23N3O2 and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-7-(1-pyridin-3-ylpropan-2-yl)quinoline-2-carboxamide.

Molecular Properties

Compound NameQuinoline derivative 3
PubChem CID89554768
Molecular FormulaC25H23N3O2
Molecular Weight397.50 g/mol
Exact Mass397.18
IUPAC Name4-(4-methoxyphenyl)-7-(1-pyridin-3-ylpropan-2-yl)quinoline-2-carboxamide
SMILESCC(CC1=CN=CC=C1)C2=CC3=C(C=C2)C(=CC(=N3)C(=O)N)C4=CC=C(C=C4)OC
InChIInChI=1S/C25H23N3O2/c1-16(12-17-4-3-11-27-15-17)19-7-10-21-22(18-5-8-20(30-2)9-6-18)14-24(25(26)29)28-23(21)13-19/h3-11,13-16H,12H2,1-2H3,(H2,26,29)
InChIKeySLSRIELIUCLTJB-UHFFFAOYSA-N
XLogP4.50
TPSA78.10 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms30
Complexity563

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500397.50
LogP ≤ 54.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze Quinoline derivative 3 with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of Quinoline derivative 3?
The IUPAC name of Quinoline derivative 3 (CID 89554768) is 4-(4-methoxyphenyl)-7-(1-pyridin-3-ylpropan-2-yl)quinoline-2-carboxamide.
What is the SMILES notation for Quinoline derivative 3?
The canonical SMILES for Quinoline derivative 3 is CC(CC1=CN=CC=C1)C2=CC3=C(C=C2)C(=CC(=N3)C(=O)N)C4=CC=C(C=C4)OC.
What is the InChIKey of Quinoline derivative 3?
The InChIKey is SLSRIELIUCLTJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O2/c1-16(12-17-4-3-11-27-15-17)19-7-10-21-22(18-5-8-20(30-2)9-6-18)14-24(25(26)29)28-23(21)13-19/h3-11,13-16H,12H2,1-2H3,(H2,26,29).
What are the key properties of Quinoline derivative 3?
Quinoline derivative 3 has a molecular weight of 397.50 g/mol, XLogP of 4.50, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Quinoline derivative 3 is sourced from PubChem (CID 89554768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).