C25H23N3O2 — CID 89554768
Quinoline derivative 3 (PubChem CID 89554768) has the molecular formula C25H23N3O2 and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-7-(1-pyridin-3-ylpropan-2-yl)quinoline-2-carboxamide.
| Compound Name | Quinoline derivative 3 |
|---|---|
| PubChem CID | 89554768 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-(4-methoxyphenyl)-7-(1-pyridin-3-ylpropan-2-yl)quinoline-2-carboxamide |
| SMILES | CC(CC1=CN=CC=C1)C2=CC3=C(C=C2)C(=CC(=N3)C(=O)N)C4=CC=C(C=C4)OC |
| InChI | InChI=1S/C25H23N3O2/c1-16(12-17-4-3-11-27-15-17)19-7-10-21-22(18-5-8-20(30-2)9-6-18)14-24(25(26)29)28-23(21)13-19/h3-11,13-16H,12H2,1-2H3,(H2,26,29) |
| InChIKey | SLSRIELIUCLTJB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | 563 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |