About 1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride
1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride (PubChem CID 89557446) has the molecular formula C15H20ClN3O3S
and a molecular weight of 357.90 g/mol. Its IUPAC name is 1-(3-aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride |
| PubChem CID | 89557446 |
| Molecular Formula | C15H20ClN3O3S |
| Molecular Weight | 357.90 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-(3-aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)NC(=S)N2CCCN)OC.Cl |
| InChI | InChI=1S/C15H19N3O3S.ClH/c1-20-12-5-4-10(8-13(12)21-2)11-9-14(19)17-15(22)18(11)7-3-6-16;/h4-5,8-9H,3,6-7,16H2,1-2H3,(H,17,19,22);1H |
| InChIKey | WCNFZBJPBWNTCP-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | 455 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride?
The IUPAC name of 1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride (CID 89557446) is 1-(3-aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride.
What is the SMILES notation for 1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride?
The canonical SMILES for 1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride is COC1=C(C=C(C=C1)C2=CC(=O)NC(=S)N2CCCN)OC.Cl.
What is the InChIKey of 1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride?
The InChIKey is WCNFZBJPBWNTCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3S.ClH/c1-20-12-5-4-10(8-13(12)21-2)11-9-14(19)17-15(22)18(11)7-3-6-16;/h4-5,8-9H,3,6-7,16H2,1-2H3,(H,17,19,22);1H.
What are the key properties of 1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride?
1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride has a molecular weight of 357.90 g/mol, XLogP of not available, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-Aminopropyl)-6-(3,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride is sourced from PubChem (CID 89557446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).