C20H22N6O2S — CID 8956180
N'-[(2R)-2-[(4-propyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]benzohydrazide (PubChem CID 8956180) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is N'-[(2R)-2-[(4-propyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]benzohydrazide.
| Compound Name | N'-[(2R)-2-[(4-propyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 8956180 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N'-[(2R)-2-[(4-propyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]benzohydrazide |
| SMILES | CCCn1c(S[C@H](C)C(=O)NNC(=O)c2ccccc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C20H22N6O2S/c1-3-13-26-17(15-9-11-21-12-10-15)22-25-20(26)29-14(2)18(27)23-24-19(28)16-7-5-4-6-8-16/h4-12,14H,3,13H2,1-2H3,(H,23,27)(H,24,28)/t14-/m1/s1 |
| InChIKey | DNBVMCLPRLIBKW-CQSZACIVSA-N |
| XLogP | 2.69 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|