C18H21N3O4 — CID 8956354
1-(1-adamantyl)-3-[(5-methyl-1,2-oxazol-3-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 8956354) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(5-methyl-1,2-oxazol-3-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(1-adamantyl)-3-[(5-methyl-1,2-oxazol-3-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 8956354 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-(1-adamantyl)-3-[(5-methyl-1,2-oxazol-3-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | Cc1cc(CN2C(=O)C(=O)N(C34CC5CC(CC(C5)C3)C4)C2=O)no1 |
| InChI | InChI=1S/C18H21N3O4/c1-10-2-14(19-25-10)9-20-15(22)16(23)21(17(20)24)18-6-11-3-12(7-18)5-13(4-11)8-18/h2,11-13H,3-9H2,1H3 |
| InChIKey | JWJFRAZYDHTSRX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|