C21H19N3O4S — CID 8956691
1-[(3S)-3-(furan-2-yl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone (PubChem CID 8956691) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is 1-[(3S)-3-(furan-2-yl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone.
| Compound Name | 1-[(3S)-3-(furan-2-yl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 8956691 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1-[(3S)-3-(furan-2-yl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-(1-oxidopyridin-1-ium-2-yl)sulfanylethanone |
| SMILES | COc1ccc(C2=NN(C(=O)CSc3cccc[n+]3[O-])[C@H](c3ccco3)C2)cc1 |
| InChI | InChI=1S/C21H19N3O4S/c1-27-16-9-7-15(8-10-16)17-13-18(19-5-4-12-28-19)24(22-17)20(25)14-29-21-6-2-3-11-23(21)26/h2-12,18H,13-14H2,1H3/t18-/m0/s1 |
| InChIKey | JEGAZFYTIOWNLF-SFHVURJKSA-N |
| XLogP | 3.39 |
| TPSA | 81.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|