C15H17F3N6O4 — CID 8960222
[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate (PubChem CID 8960222) has the molecular formula C15H17F3N6O4 and a molecular weight of 402.33 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
|---|---|
| PubChem CID | 8960222 |
| Molecular Formula | C15H17F3N6O4 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] 3-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoate |
| SMILES | Cc1nc2ncnn2c(C)c1CCC(=O)OCC(=O)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C15H17F3N6O4/c1-8-10(9(2)24-13(22-8)20-7-21-24)3-4-12(26)28-5-11(25)23-14(27)19-6-15(16,17)18/h7H,3-6H2,1-2H3,(H2,19,23,25,27) |
| InChIKey | ZTEOLAKELSUOMS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |