About N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide
N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide (PubChem CID 896056) has the molecular formula C14H13N3O3
and a molecular weight of 271.28 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide.
Molecular Properties
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide |
| PubChem CID | 896056 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide |
| SMILES | Cc1cc(C)nc(NC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C14H13N3O3/c1-9-6-10(2)15-13(7-9)16-14(18)11-4-3-5-12(8-11)17(19)20/h3-8H,1-2H3,(H,15,16,18) |
| InChIKey | ROJMMHXBAJFXHL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide?
The IUPAC name of N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide (CID 896056) is N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide.
What is the SMILES notation for N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide?
The canonical SMILES for N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide is Cc1cc(C)nc(NC(=O)c2cccc([N+](=O)[O-])c2)c1.
What is the InChIKey of N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide?
The InChIKey is ROJMMHXBAJFXHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O3/c1-9-6-10(2)15-13(7-9)16-14(18)11-4-3-5-12(8-11)17(19)20/h3-8H,1-2H3,(H,15,16,18).
What are the key properties of N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide?
N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide has a molecular weight of 271.28 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethyl-2-pyridinyl)-3-nitrobenzamide is sourced from PubChem (CID 896056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).