C19H17NO4S2 — CID 8961251
(4-methoxycarbonylphenyl) 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate (PubChem CID 8961251) has the molecular formula C19H17NO4S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate.
| Compound Name | (4-methoxycarbonylphenyl) 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 8961251 |
| Molecular Formula | C19H17NO4S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (4-methoxycarbonylphenyl) 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)benzoate |
| SMILES | COC(=O)c1ccc(OC(=O)c2ccccc2CSC2=NCCS2)cc1 |
| InChI | InChI=1S/C19H17NO4S2/c1-23-17(21)13-6-8-15(9-7-13)24-18(22)16-5-3-2-4-14(16)12-26-19-20-10-11-25-19/h2-9H,10-12H2,1H3 |
| InChIKey | HECDBSMOPUDWMU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|